PCB-47


aroclor 1242; 2,4-dichloro-1-(2,4-dichlorophenyl)benzene; 2,2',4,4'-PCB; PCB-47; 2,2',4,4'-tetrachlorobiphenyl
Links:🕷 ChemSpider, 📖 PubMed
MeSH:Environmental Pollutants
CAS:[2437-79-8]
Formula:C12H6Cl4; 291.99 g/mol
InChiKey:QORAVNMWUNPXAO-UHFFFAOYSA-N
SMILES:Clc1ccc(c(Cl)c1)c2ccc(Cl)cc2Cl
Molecular structure of 2,2',4,4'-tetrachlorobiphenyl
Melting point:83 °C
Log10 partition octanol / water:6.29

Isomers

2,2',3,3'-tetrachlorobiphenyl
Molecular structure of 2,2',3,3'-tetrachlorobiphenyl
2,2',3,4-tetrachlorobiphenyl
Molecular structure of 2,2',3,4-tetrachlorobiphenyl
2,2',3,4'-tetrachlorobiphenyl
Molecular structure of 2,2',3,4'-tetrachlorobiphenyl
2,2',3,5'-tetrachlorobiphenyl
Molecular structure of 2,2',3,5'-tetrachlorobiphenyl
2,2',3,6'-tetrachlorobiphenyl
Molecular structure of 2,2',3,6'-tetrachlorobiphenyl
2,2',4,4'-tetrachlorobiphenyl
Molecular structure of 2,2',4,4'-tetrachlorobiphenyl
2,2',4,5-tetrachlorobiphenyl
Molecular structure of 2,2',4,5-tetrachlorobiphenyl
2,2',4,5'-tetrachlorobiphenyl
Molecular structure of 2,2',4,5'-tetrachlorobiphenyl
2,2',4,6-tetrachlorobiphenyl
Molecular structure of 2,2',4,6-tetrachlorobiphenyl
2,2',4,6'-tetrachlorobiphenyl
Molecular structure of 2,2',4,6'-tetrachlorobiphenyl
2,2',5,5'-tetrachlorobiphenyl
Molecular structure of 2,2',5,5'-tetrachlorobiphenyl
2,2',5,6'-tetrachlorobiphenyl
Molecular structure of 2,2',5,6'-tetrachlorobiphenyl
2,2',6,6'-tetrachlorobiphenyl
Molecular structure of 2,2',6,6'-tetrachlorobiphenyl
2,3,3',4-tetrachlorobiphenyl
Molecular structure of 2,3,3',4-tetrachlorobiphenyl
2,3,3',4'-tetrachlorobiphenyl
Molecular structure of 2,3,3',4'-tetrachlorobiphenyl
2,3,3',5'-tetrachlorobiphenyl
Molecular structure of 2,3,3',5'-tetrachlorobiphenyl
2,3,4,4'-tetrachlorobiphenyl
Molecular structure of 2,3,4,4'-tetrachlorobiphenyl
2,3,4,5-tetrachlorobiphenyl
Molecular structure of 2,3,4,5-tetrachlorobiphenyl
2,3,4',5-tetrachlorobiphenyl
Molecular structure of 2,3,4',5-tetrachlorobiphenyl
2,3,4',6-tetrachlorobiphenyl
Molecular structure of 2,3,4',6-tetrachlorobiphenyl
2,3,5,6-tetrachlorobiphenyl
Molecular structure of 2,3,5,6-tetrachlorobiphenyl
2,3',4,4'-tetrachlorobiphenyl
Molecular structure of 2,3',4,4'-tetrachlorobiphenyl
2,3',4,5-tetrachlorobiphenyl
Molecular structure of 2,3',4,5-tetrachlorobiphenyl
2,3',4,6-tetrachlorobiphenyl
Molecular structure of 2,3',4,6-tetrachlorobiphenyl
2,3',4',5-tetrachlorobiphenyl
Molecular structure of 2,3',4',5-tetrachlorobiphenyl
2,3',4',6-tetrachlorobiphenyl
Molecular structure of 2,3',4',6-tetrachlorobiphenyl
2,4,4',5-tetrachlorobiphenyl
Molecular structure of 2,4,4',5-tetrachlorobiphenyl
2,4,4',6-tetrachlorobiphenyl
Molecular structure of 2,4,4',6-tetrachlorobiphenyl
2',3,4,5-tetrachlorobiphenyl
Molecular structure of 2',3,4,5-tetrachlorobiphenyl
3,3',4,4'-tetrachlorobiphenyl
Molecular structure of 3,3',4,4'-tetrachlorobiphenyl
3,3',5,5'-tetrachlorobiphenyl
Molecular structure of 3,3',5,5'-tetrachlorobiphenyl
3,4,4',5-tetrachlorobiphenyl
Molecular structure of 3,4,4',5-tetrachlorobiphenyl
1,2,5-trichloro-3-(2-chlorophenyl)benzene
Molecular structure of 1,2,5-trichloro-3-(2-chlorophenyl)benzene