PCB-8


2,4'-dichlorobiphenyl; 2,4'-PCB; PCB-8
Links:📏 NIST, 📖 PubMed
CAS:[34883-43-7]
Formula:C12H8Cl2; 223.10 g/mol
InChiKey:UFNIBRDIUNVOMX-UHFFFAOYSA-N
SMILES:Clc1ccc(cc1)c2ccccc2Cl
Molecular structure of 2,4'-dichlorobiphenyl
Melting point:44 °C
Log10 partition octanol / water:5.09

Isomers

cis-1,2-dichloroacenaphthene
Molecular structure of cis-1,2-dichloroacenaphthene
trans-1,2-dichloroacenaphthene
Molecular structure of trans-1,2-dichloroacenaphthene
5,6-dichloroacenaphthene
Molecular structure of 5,6-dichloroacenaphthene
2,2'-dichlorobiphenyl
Molecular structure of 2,2'-dichlorobiphenyl
2,3-dichlorobiphenyl
Molecular structure of 2,3-dichlorobiphenyl
2,3'-dichlorobiphenyl
Molecular structure of 2,3'-dichlorobiphenyl
2,4-dichlorobiphenyl
Molecular structure of 2,4-dichlorobiphenyl
2,4'-dichlorobiphenyl
Molecular structure of 2,4'-dichlorobiphenyl
2,5-dichlorobiphenyl
Molecular structure of 2,5-dichlorobiphenyl
2,6-dichlorobiphenyl
Molecular structure of 2,6-dichlorobiphenyl
3,3'-dichlorobiphenyl
Molecular structure of 3,3'-dichlorobiphenyl
3,4-dichlorobiphenyl
Molecular structure of 3,4-dichlorobiphenyl
3,4'-dichlorobiphenyl
Molecular structure of 3,4'-dichlorobiphenyl
3,5-dichlorobiphenyl
Molecular structure of 3,5-dichlorobiphenyl
4,4'-dichlorobiphenyl
Molecular structure of 4,4'-dichlorobiphenyl