aconitic acid


aconitic acid; 1-propene-1,2,3-tricarboxylic acid
Links:📖 PubMed,
📖Houben-Weyl, 2. Band (Aconitsäure); p. 824,
📖Org. Chem., v. Richter, 1. Vol (Aconitic Acid); p. 594, 610
CAS:[499-12-7]
Formula:C6H6O6; 174.11 g/mol
InChiKey:GTZCVFVGUGFEME-UHFFFAOYSA-N
SMILES:OC(=O)CC(=CC(O)=O)C(O)=O
Molecular structure of aconitic acid
Melting point:191 °C
1g dissolves in:
49.75g formic acid

Isomers

aconitic acid
Molecular structure of aconitic acid
dehydroascorbic acid
Molecular structure of dehydroascorbic acid
(1E)-1-propene-1,2,3-tricarboxylic acid
Molecular structure of (1E)-1-propene-1,2,3-tricarboxylic acid
(1Z)-1-propene-1,2,3-tricarboxylic acid
Molecular structure of (1Z)-1-propene-1,2,3-tricarboxylic acid