aconitine


aconitine
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
MeSH:Immunologic Factors; Sodium Channel Agonists; Voltage-Gated Sodium Channel Agonists
CAS:[302-27-2]
Formula:C34H47NO11; 645.75 g/mol
InChiKey:XFSBVAOIAHNAPC-XTHSEXKGSA-N
SMILES:CCN1C[C@]2(COC)[C@H](O)C[C@H](OC)[C@@]34[C@@H]5C[C@]6(O)[C@@H](OC)[C@H](O)[C@](OC(C)=O)([C@@H]([C@H](OC)[C@H]23)C14)[C@H]5[C@H]6OC(=O)c7ccccc7
Molecular structure of aconitine
Melting point:204 °C
1g dissolves in:
5.60g benzene;    22.03g ethanol;    44.05g diethyl ether;    50.25g tetrachloromethane;    3,225.81g water;    3,571.43g hexane