arbutin


arbutin
Links:🕷 ChemSpider, 📖 PubMed
CAS:[497-76-7]
Formula:C12H16O7; 272.25 g/mol
InChiKey:BJRNKVDFDLYUGJ-UHFFFAOYSA-N
SMILES:OCC1OC(Oc2ccc(O)cc2)C(O)C(O)C1O
Molecular structure of arbutin
Melting point:198 °C
Log10 partition octanol / water:1.35
1g dissolves in:
9,090.91g trichloroethene

Isomers

arbutin
Molecular structure of arbutin
3,4,6-tri-O-acetyl-D-glucal
Molecular structure of 3,4,6-tri-O-acetyl-D-glucal