benzene-1,2,3-tricarboxylic acid

Home   ::   Tables for Chemistry   ::   Compound classes

1,2,3-benzenetricarboxylic acid; benzene-1,2,3-tricarboxylic acid; hemimellitic acid
Links:📏 NIST, 📖 PubMed
CAS RN:[569-51-7]
Formula:C9H6O6; 210.14 g/mol
InChiKey:UJMDYLWCYJJYMO-UHFFFAOYSA-N
SMILES:OC(=O)c1cccc(C(O)=O)c1C(O)=O
Molecular structure of benzene-1,2,3-tricarboxylic acid
Melting point:200 °C

Isomers

benzene-1,2,3-tricarboxylic acid
Molecular structure of benzene-1,2,3-tricarboxylic acid
benzene-1,2,4-tricarboxylic acid
Molecular structure of benzene-1,2,4-tricarboxylic acid
1,3,5-benzenetricarboxylic acid
Molecular structure of 1,3,5-benzenetricarboxylic acid
hydrastic acid
Molecular structure of hydrastic acid
  ::