benzene-1,3,5-triol dihydrate


benzene-1,3,5-triol dihydrate; phloroglucinol dihydrate; 1,3,5-trihydroxybenzene dihydrate
Links:🕷 ChemSpider
CAS:[6099-90-7]
Formula:C6H10O5; 162.14 g/mol
InChiKey:MPYXTIHPALVENR-UHFFFAOYSA-N
SMILES:O.O.Oc1cc(O)cc(O)c1
Molecular structure of benzene-1,3,5-triol dihydrate
Melting point:220 °C
Log10 partition octanol / water:0.16
1g dissolves in:
0.34g pyridine;    88.50g water

Isomers

1,6 anhydro-β-D-allopyranose
Molecular structure of 1,6 anhydro-b-D-allopyranose
1,6-anhydro-β-D-glucopyranose
Molecular structure of 1,6-anhydro-b-D-glucopyranose
benzene-1,3,5-triol dihydrate
Molecular structure of benzene-1,3,5-triol dihydrate
conduritol epoxide
Molecular structure of conduritol epoxide
diethyl dicarbonate
Molecular structure of diethyl dicarbonate
diethyl pyrocarbonate
Molecular structure of diethyl pyrocarbonate
dimethyl (2R)-2-hydroxybutanedioate
Molecular structure of dimethyl (2R)-2-hydroxybutanedioate
dimethyl (2S)-2-hydroxybutanedioate
Molecular structure of dimethyl (2S)-2-hydroxybutanedioate
dimethyl 2-hydroxybutanedioate
Molecular structure of dimethyl 2-hydroxybutanedioate
ethoxysuccinic acid
Molecular structure of ethoxysuccinic acid
3-hydroxy-2,2-dimethylbutanedioic acid
Molecular structure of 3-hydroxy-2,2-dimethylbutanedioic acid
meglutol
Molecular structure of meglutol
methyl 2-methoxycarbonyloxypropanoate
Molecular structure of methyl 2-methoxycarbonyloxypropanoate