benzene-1,3-dicarboxylic acid


m-benzenedicarboxylic acid; 1,3-benzenedicarboxylic acid; benzene-1,3-dicarboxylic acid; isophthalic acid; m-phthalic acid
Links:📏 NIST, ⚗️ ChemSynthesis
CAS:[121-91-5]
Formula:C8H6O4; 166.13 g/mol
InChiKey:QQVIHTHCMHWDBS-UHFFFAOYSA-N
SMILES:OC(=O)c1cccc(c1)C(O)=O
Molecular structure of benzene-1,3-dicarboxylic acid
Density:1.540 g/mL
Molar volume:107.9 mL/mol
Dipole moment:2.27 D
Melting point:347 °C
Log10 partition octanol / water:1.66
1g dissolves in:
7,692.31g water

Isomers

benzene-1,3-dicarboxylic acid
Molecular structure of benzene-1,3-dicarboxylic acid
benzene-1,4-dicarboxylic acid
Molecular structure of benzene-1,4-dicarboxylic acid
2-(3,6-dioxo-1-cyclohexa-1,4-dienyl)acetic acid
Molecular structure of 2-(3,6-dioxo-1-cyclohexa-1,4-dienyl)acetic acid
exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride
Molecular structure of exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride
3-formyl-2-hydroxybenzoic acid
Molecular structure of 3-formyl-2-hydroxybenzoic acid
3-formyl-4-hydroxybenzoic acid
Molecular structure of 3-formyl-4-hydroxybenzoic acid
4-formyl-3-hydroxybenzoic acid
Molecular structure of 4-formyl-3-hydroxybenzoic acid
5-formylsalicylic acid
Molecular structure of 5-formylsalicylic acid
3,4-(methylenedioxy)benzoic acid
Molecular structure of 3,4-(methylenedioxy)benzoic acid
phthalic acid
Molecular structure of phthalic acid