biphenyl


biphenyl; 1,1'-biphenyl; diphenyl; PCB-0; phenylbenzene
Links:🌍 Wikipedia, 📏 NIST, 🕷 ChemSpider, ⚗️ OrgSyn, 📖 PubMed
MeSH:Fungicides, Industrial; Pesticides
CAS:[92-52-4]
Formula:C12H10; 154.21 g/mol
InChiKey:ZUOUZKKEUPVFJK-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c2ccccc2
Molecular structure of biphenyl
Density:0.990 g/mL
Molar volume:155.8 mL/mol
Refractive index:1.614
Molecular refractive power:54.31 mL/mol
Dielectric constant:2.53
Dipole moment:0.00 D
Melting point:69 °C
Boiling point:255 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Critical temperature:516 °C
Critical pressure:3.4 atm
Critical volume:502.00 ml/mol
Log10 partition octanol / water:3.76
1g dissolves in:
10.02g ethanol;    15.22g methanol

Isomers

acenaphthene
Molecular structure of acenaphthene
biphenyl
Molecular structure of biphenyl
1-ethenylnaphthalene
Molecular structure of 1-ethenylnaphthalene
heptalene
Molecular structure of heptalene
2-vinylnaphthalene
Molecular structure of 2-vinylnaphthalene