carbazole


9-azafluorene; carbazole; 9H-carbazole; carprofen related compound A; dibenzopyrrole; diphenylenimine
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis,
📖Houben-Weyl, 2. Band (Carbazol); p. 75, 87, 93, 272, 594, 628
MeSH:Carcinogens; Noxae
CAS:[86-74-8]
Formula:C12H9N; 167.21 g/mol
InChiKey:UJOBWOGCFQCDNV-UHFFFAOYSA-N
SMILES:[nH]1c2ccccc2c3ccccc13
Molecular structure of carbazole
Density:1.301 g/mL
Molar volume:128.5 mL/mol
Dipole moment:2.11 D
Melting point:247 °C
Boiling point:353 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:3.72
1g dissolves in:
108.70g ethanol;    181.82g toluene

Isomers

carbazole
Molecular structure of carbazole
1-naphthylacetonitrile
Molecular structure of 1-naphthylacetonitrile
2-naphthylacetonitrile
Molecular structure of 2-naphthylacetonitrile