cholesterol


(3β)-cholest-5-en-3-ol; cholesterol; λ-cholesterol; (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[α]phenanthren-3-ol
Links:🌍 Wikipedia, 📖 PubMed
CAS:[57-88-5]
Formula:C27H46O; 386.66 g/mol
InChiKey:HVYWMOMLDIMFJA-DPAQBDIFSA-N
SMILES:CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Molecular structure of cholesterol
Density:1.067 g/mL
Molar volume:362.4 mL/mol
Melting point:149 °C
Boiling point:360 °C
1g dissolves in:
1.47g pyridine;    384.62g water

Isomers

allocholesterol
Molecular structure of allocholesterol
cholestanone
Molecular structure of cholestanone
5α-cholestan-3-one
Molecular structure of 5a-cholestan-3-one
cholesterol
Molecular structure of cholesterol