cytisine


baptitoxine; (-)-cytisine; cytisine; (1R,5S)-1,2,3,4,5,6-hexahydro-1,5-methano-8H-pyrido[1,2α][1,5]diazocin-8-one; sophorine; ulexine
Links:🌍 Wikipedia, 🕷 ChemSpider, 📖 PubMed
CAS:[485-35-8]
Formula:C11H14N2O; 190.24 g/mol
InChiKey:ANJTVLIZGCUXLD-IUCAKERBSA-N
SMILES:O=C1C=CC=C2[C@@H]3CNC[C@H](C3)CN12
Molecular structure of cytisine
Melting point:153 °C
Boiling point:218 °C
1g dissolves in:
79.37g 4,4'-diaminobiphenyl;    330.03g pentanol

Isomers

3-(1-aminopropan-2-yl)-1H-indol-5-ol
Molecular structure of 3-(1-aminopropan-2-yl)-1H-indol-5-ol
1-benzyl-3-oxopiperazine
Molecular structure of 1-benzyl-3-oxopiperazine
cytisine
Molecular structure of cytisine
3,3-dimethyl-2,3-dihydro-1H-indole-2-carboxamide
Molecular structure of 3,3-dimethyl-2,3-dihydro-1H-indole-2-carboxamide
(4R,5S)-(-)-1,5-dimethyl-4-phenyl-2-imidazolidinone
Molecular structure of (4R,5S)-(-)-1,5-dimethyl-4-phenyl-2-imidazolidinone
(4S,5R)-(+)-1,5-dimethyl-4-phenyl-2-imidazolidinone
Molecular structure of (4S,5R)-(+)-1,5-dimethyl-4-phenyl-2-imidazolidinone
4,4-dimethyl-1-phenyl-3-pyrazolidinone
Molecular structure of 4,4-dimethyl-1-phenyl-3-pyrazolidinone
2-ethyl-2-methyl-1,2,3,4-tetrahydro-4-oxoquinazoline
Molecular structure of 2-ethyl-2-methyl-1,2,3,4-tetrahydro-4-oxoquinazoline
3-(2-hydroxyethyl-phenylamino)propanenitrile
Molecular structure of 3-(2-hydroxyethyl-phenylamino)propanenitrile
2-(5-methoxy-1H-indol-3-yl)ethanamine
Molecular structure of 2-(5-methoxy-1H-indol-3-yl)ethanamine
6-methoxytryptamine
Molecular structure of 6-methoxytryptamine
(S)-1-[(R)-α-methylbenzyl)aziridine-2-carboxamide
Molecular structure of (S)-1-[(R)-a-methylbenzyl)aziridine-2-carboxamide
6-(1-piperidinyl)pyridine-3-carboxaldehyde
Molecular structure of 6-(1-piperidinyl)pyridine-3-carboxaldehyde
1,2,2-trimethyl-1,2,3,4-tetrahydro-4-oxoquinazoline
Molecular structure of 1,2,2-trimethyl-1,2,3,4-tetrahydro-4-oxoquinazoline