dantron


chrysazin; danthron; dantron; 1,8-dihydroxy-9,10-anthracenedione; 1,8-dihydroxyanthracene-9,10-dione; 1,8-dihydroxyanthraquinone
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
MeSH:Cathartics; Gastrointestinal Agents; Mutagens; Noxae; Cathartics; Gastrointestinal Agents; Mutagens; Noxae
CAS:[117-10-2]
Formula:C14H8O4; 240.22 g/mol
InChiKey:QBPFLULOKWLNNW-UHFFFAOYSA-N
SMILES:Oc1cccc2C(=O)c3cccc(O)c3C(=O)c12
Molecular structure of dantron
Melting point:193 °C
Log10 partition octanol / water:3.80
1g dissolves in:
632,911.39g water

Isomers

dantron
Molecular structure of dantron
1,2-dihydroxy-9,10-anthracenedione
Molecular structure of 1,2-dihydroxy-9,10-anthracenedione
1,5-dihydroxyanthracene-9,10-dione
Molecular structure of 1,5-dihydroxyanthracene-9,10-dione
2,6-dihydroxyanthracene-9,10-dione
Molecular structure of 2,6-dihydroxyanthracene-9,10-dione
2,7-dihydroxy-9,10-anthracenedione
Molecular structure of 2,7-dihydroxy-9,10-anthracenedione
1,4-dihydroxyanthraquinone
Molecular structure of 1,4-dihydroxyanthraquinone