diazoaminobenzene


diazoaminobenzene; 1,3-diphenyltriazene; 1,3-diphenyl-1-triazene; N-phenyldiazenylaniline
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS:[136-35-6]
Formula:C12H11N3; 197.24 g/mol
InChiKey:ALIFPGGMJDWMJH-UHFFFAOYSA-N
SMILES:N(N=Nc1ccccc1)c2ccccc2
Molecular structure of diazoaminobenzene
Melting point:98 °C
1g dissolves in:
0.73g pyridine;    2,000.00g water

Isomers

4-aminoazobenzene
Molecular structure of 4-aminoazobenzene
3-amino-1-methyl-5H-pyrido[4,3-β]indole
Molecular structure of 3-amino-1-methyl-5H-pyrido[4,3-b]indole
diazoaminobenzene
Molecular structure of diazoaminobenzene
2-[(4-dimethylaminophenyl)methylidene]propanedinitrile
Molecular structure of 2-[(4-dimethylaminophenyl)methylidene]propanedinitrile
3-isopropyl-2-quinoxalinecarbonitrile
Molecular structure of 3-isopropyl-2-quinoxalinecarbonitrile