erythritol


(2R,3S)-butane-1,2,3,4-tetraol; erythritol
Links:📖 PubMed,
📖Houben-Weyl, 2. Band (Erythrit); p. 25, 502
CAS:[10030-58-7]
Formula:C4H10O4; 122.12 g/mol
InChiKey:UNXHWFMMPAWVPI-ZXZARUISSA-N
SMILES:OC[C@@H](O)[C@@H](O)CO
Molecular structure of erythritol
Density:1.450 g/mL
Molar volume:84.2 mL/mol
Dielectric constant:28.20
Melting point:122 °C
Boiling point:329 °C
Log10 partition octanol / water:-2.29
1g dissolves in:
1.63g water;    40.00g pyridine

Isomers

bis(1-hydroxyethyl) peroxide
Molecular structure of bis(1-hydroxyethyl) peroxide
erythritol
Molecular structure of erythritol
meso-erythritol
Molecular structure of meso-erythritol
D-threitol
Molecular structure of D-threitol
DL-threitol
Molecular structure of DL-threitol
L-threitol
Molecular structure of L-threitol