methyl 2,6-dichlorobenzoate

Home   ::   Tables for Chemistry   ::   Compound classes

2,6-dichlorobenzoic acid methyl ester; methyl 2,6-dichlorobenzoate
CAS RN:[14920-87-7]
Formula:C8H6Cl2O2; 205.04 g/mol
InChiKey:HEYGSGDIWJDORA-UHFFFAOYSA-N
SMILES:COC(=O)c1c(Cl)cccc1Cl
Molecular structure of methyl 2,6-dichlorobenzoate
Density:1.528 g/mL
Molar volume:134.2 mL/mol
Melting point:28 °C
Log10 partition octanol / water:2.79

Isomers

(3-chlorophenoxy)acetyl chloride
Molecular structure of (3-chlorophenoxy)acetyl chloride
(4-chlorophenoxy)acetyl chloride
Molecular structure of (4-chlorophenoxy)acetyl chloride
6-chloropiperonyl chloride
Molecular structure of 6-chloropiperonyl chloride
3',5'-dichloro-2'-hydroxyacetophenone
Molecular structure of 3',5'-dichloro-2'-hydroxyacetophenone
2,4-dichlorophenyl acetate
Molecular structure of 2,4-dichlorophenyl acetate
2,6-dichlorophenyl acetate
Molecular structure of 2,6-dichlorophenyl acetate
2,3-dichlorophenylacetic acid
Molecular structure of 2,3-dichlorophenylacetic acid
2,4-dichlorophenylacetic acid
Molecular structure of 2,4-dichlorophenylacetic acid
2,6-dichlorophenylacetic acid
Molecular structure of 2,6-dichlorophenylacetic acid
3,4-dichlorophenylacetic acid
Molecular structure of 3,4-dichlorophenylacetic acid
methyl 2,4-dichlorobenzoate
Molecular structure of methyl 2,4-dichlorobenzoate
methyl 2,5-dichlorobenzoate
Molecular structure of methyl 2,5-dichlorobenzoate
methyl 2,6-dichlorobenzoate
Molecular structure of methyl 2,6-dichlorobenzoate
methyl 3,4-dichlorobenzoate
Molecular structure of methyl 3,4-dichlorobenzoate
methyl 3,5-dichlorobenzoate
Molecular structure of methyl 3,5-dichlorobenzoate
  ::