methyl 4-methylfurazancarboxylate 2-oxide

Home   ::   Tables for Chemistry   ::   Compound classes

methyl 4-methylfurazancarboxylate 2-oxide
Links:🕷 ChemSpider
Formula:C5H6N2O4; 158.11 g/mol
InChiKey:MFVHIKWWFUWEDD-UHFFFAOYSA-N
SMILES:COC(=O)c1c(C)no[n+]1[O-]
Molecular structure of methyl 4-methylfurazancarboxylate 2-oxide
Log10 partition octanol / water:0.69

Isomers

N-carbamoylmaleamic acid
Molecular structure of N-carbamoylmaleamic acid
L-dihydroorotic acid
Molecular structure of L-dihydroorotic acid
hydantoin-5-acetic acid
Molecular structure of hydantoin-5-acetic acid
D-hydroorotic acid
Molecular structure of D-hydroorotic acid
ibotenic acid
Molecular structure of ibotenic acid
methyl 4-methylfurazancarboxylate 2-oxide
Molecular structure of methyl 4-methylfurazancarboxylate 2-oxide
  ::