methylene blue


C.I. 52015; [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylammonium chloride; (7-dimethylaminophenothiazin-3-ylidene)-dimethylazanium chloride; methylene blue
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed,
📖Houben-Weyl, 2. Band (Methylenblau); p. 103, 225, 921
MeSH:Enzyme Inhibitors
CAS:[61-73-4]
Formula:C16H18ClN3S; 319.86 g/mol
InChiKey:CXKWCBBOMKCUKX-UHFFFAOYSA-M
SMILES:[Cl-].CN(C)c1ccc2nc3ccc(cc3[s+]c2c1)N(C)C
Molecular structure of methylene blue
Melting point:180 °C
1g dissolves in:
22.94g water;    384.62g pyridine