myo-inositol


(1R,2R,3S,4S,5R,6S)-cyclohexane-1,2,3,4,5,6-hexol; inositol; isoinositol; myo-inositol
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Inosit); p. 47
MeSH:Growth Substances; Vitamin B Complex
CAS:[87-89-8]
US Adopted Name:inositol
Formula:C6H12O6; 180.16 g/mol
InChiKey:CDAISMWEOUEBRE-UHFFFAOYSA-N
SMILES:OC1C(O)C(O)C(O)C(O)C1(O)
Molecular structure of myo-inositol
Density:1.752 g/mL
Molar volume:102.8 mL/mol
Melting point:226 °C
1g dissolves in:
3.98g water

Isomers

allo-inositol
Molecular structure of allo-inositol
α-D-allopyranose
Molecular structure of a-D-allopyranose
β-D-allopyranose
Molecular structure of b-D-allopyranose
α-D-altropyranose
Molecular structure of a-D-altropyranose
β-D-altropyranose
Molecular structure of b-D-altropyranose
2,5-bis(hydroxymethyl)-1,4-dioxane-2,5-diol
Molecular structure of 2,5-bis(hydroxymethyl)-1,4-dioxane-2,5-diol
D-(+)-chiro-inositol
Molecular structure of D-(+)-chiro-inositol
L-chiro-inositol
Molecular structure of L-chiro-inositol
epi-inositol
Molecular structure of epi-inositol
β-D-fructofuranose
Molecular structure of b-D-fructofuranose
fructose
Molecular structure of fructose
α-D-galactopyranose
Molecular structure of a-D-galactopyranose
β-D-galactopyranose
Molecular structure of b-D-galactopyranose
α-D-glucofuranose
Molecular structure of a-D-glucofuranose
α-D-glucopyranose
Molecular structure of a-D-glucopyranose
β-D-glucopyranose
Molecular structure of b-D-glucopyranose
D-glucose
Molecular structure of D-glucose
cis-inositol
Molecular structure of cis-inositol
levoglucose
Molecular structure of levoglucose
α-D-mannopyranose
Molecular structure of a-D-mannopyranose
β-D-mannopyranose
Molecular structure of b-D-mannopyranose
muco-inositol
Molecular structure of muco-inositol
myo-inositol
Molecular structure of myo-inositol
neo-inositol
Molecular structure of neo-inositol
scyllo-inositol
Molecular structure of scyllo-inositol