noscapine


(3S)-6,7-dimethoxy-3-[(5R)-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-γ]isoquinolin-5-yl]-3H-2-benzofuran-1-one; narcotine; noscapine
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Narcotin); p. 683
MeSH:Central Nervous System Agents
CAS:[128-62-1]
Formula:C22H23NO7; 413.43 g/mol
InChiKey:AKNNEGZIBPJZJG-MSOLQXFVSA-N
SMILES:COc1ccc2[C@H](OC(=O)c2c1OC)[C@@H]3N(C)CCc4cc5OCOc5c(OC)c34
Molecular structure of noscapine
Melting point:176 °C
1g dissolves in:
1.88g 2-propanone;    4.00g aniline;    15.38g trichloroethene;    43.48g pyridine;    58.82g piperidine;    96.15g tetrachloromethane;    250.00g diethylamine;    22,471.91g water

Isomers

(S,R)-noscapine
Molecular structure of (S,R)-noscapine
noscapine
Molecular structure of noscapine