octanedioic acid


octanedioic acid; suberic acid
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Korksäure); p. 119, 248, 254, 891
CAS:[505-48-6]
Formula:C8H14O4; 174.20 g/mol
InChiKey:TYFQFVWCELRYAO-UHFFFAOYSA-N
SMILES:OC(=O)CCCCCCC(O)=O
Molecular structure of octanedioic acid
Melting point:142 °C
Boiling point:346 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Critical pressure:3.0 atm
1g dissolves in:
3.92g methanol;    5.46g ethanol;    7.19g propanol;    46.95g formic acid;    625.00g water

Isomers

2-acetoxyethyl butanoate
Molecular structure of 2-acetoxyethyl butanoate
butyl hydrogen butanedioate
Molecular structure of butyl hydrogen butanedioate
tert-butyl methyl malonate
Molecular structure of tert-butyl methyl malonate
1,4-diacetoxybutane
Molecular structure of 1,4-diacetoxybutane
(R,S)-2,3-diacetoxybutane
Molecular structure of (R,S)-2,3-diacetoxybutane
2,3-diacetoxybutane
Molecular structure of 2,3-diacetoxybutane
diethyl butanedioate
Molecular structure of diethyl butanedioate
2,2-diethylbutanedioic acid
Molecular structure of 2,2-diethylbutanedioic acid
diethyl 2-methylpropanedioate
Molecular structure of diethyl 2-methylpropanedioate
(2R,3S)-2,3-diethylsuccinic acid
Molecular structure of (2R,3S)-2,3-diethylsuccinic acid
rac-2,3-diethylsuccinic acid
Molecular structure of rac-2,3-diethylsuccinic acid
2,5-dihydroperoxy-2,5-dimethylhex-3-yne
Molecular structure of 2,5-dihydroperoxy-2,5-dimethylhex-3-yne
diisopropyl oxalate
Molecular structure of diisopropyl oxalate
dimethyl (2R,3S)-2,3-dimethylbutanedioate
Molecular structure of dimethyl (2R,3S)-2,3-dimethylbutanedioate
dimethyl δ,λ-2,3-dimethylsuccinate
Molecular structure of dimethyl d,l-2,3-dimethylsuccinate
dimethyl hexanedioate
Molecular structure of dimethyl hexanedioate
dimethyl methylethylpropanedioate
Molecular structure of dimethyl methylethylpropanedioate
dimethyl 3-methylglutarate
Molecular structure of dimethyl 3-methylglutarate
dimethyl 2-methylpentanedioate
Molecular structure of dimethyl 2-methylpentanedioate
dimethyl n-propylmalonate
Molecular structure of dimethyl n-propylmalonate
dipropyl oxalate
Molecular structure of dipropyl oxalate
ethylene glycol dipropionate
Molecular structure of ethylene glycol dipropionate
ethyl hydrogen hexanedioate
Molecular structure of ethyl hydrogen hexanedioate
ethyl (2-methyl-1,3-dioxolan-2-yl)acetate
Molecular structure of ethyl (2-methyl-1,3-dioxolan-2-yl)acetate
3-ethyl-3-methylpentanedioic acid
Molecular structure of 3-ethyl-3-methylpentanedioic acid
2-ethyl-2-propylpropanedioic acid
Molecular structure of 2-ethyl-2-propylpropanedioic acid
hydrogen mono-tert-butyl succinate
Molecular structure of hydrogen mono-tert-butyl succinate
2-[4-(2-hydroxyethoxy)but-2-ynoxy]ethanol
Molecular structure of 2-[4-(2-hydroxyethoxy)but-2-ynoxy]ethanol
3-isopropylglutaric acid
Molecular structure of 3-isopropylglutaric acid
isosorbide dimethyl ether
Molecular structure of isosorbide dimethyl ether
2-(3-methylbutyl)propanedioic acid
Molecular structure of 2-(3-methylbutyl)propanedioic acid
methyl (4R,5S)-2,2,5-trimethyl-1,3-dioxolane-4-carboxylate
Molecular structure of methyl (4R,5S)-2,2,5-trimethyl-1,3-dioxolane-4-carboxylate
octanedioic acid
Molecular structure of octanedioic acid
pentylmalonic acid
Molecular structure of pentylmalonic acid
propyl 2-acetyloxypropanoate
Molecular structure of propyl 2-acetyloxypropanoate
3-propylpentanedioic acid
Molecular structure of 3-propylpentanedioic acid
quetol 651
Molecular structure of quetol 651
2,2,3,3-tetramethylbutanedioic acid
Molecular structure of 2,2,3,3-tetramethylbutanedioic acid