phenolphthalein


3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one; 3,3-bis(4-hydroxyphenyl)-1(3~H)-isobenzofuranone; phenolphthalein
Links:🌍 Wikipedia, 📏 NIST, 🕷 ChemSpider, 📖 PubMed,
📖Houben-Weyl, 2. Band (Phenolphtalein); p. 195, 719
MeSH:Indicators and Reagents
CAS:[77-09-8]
Formula:C20H14O4; 318.33 g/mol
InChiKey:KJFMBFZCATUALV-UHFFFAOYSA-N
SMILES:Oc1ccc(cc1)C2(OC(=O)c3ccccc23)c4ccc(O)cc4
Molecular structure of phenolphthalein
Density:1.277 g/mL
Molar volume:249.3 mL/mol
Melting point:258 °C
Log10 partition octanol / water:2.41
1g dissolves in:
5,714.29g water

Isomers

1,3-bisbenzoyloxybenzene
Molecular structure of 1,3-bisbenzoyloxybenzene
1,4-bis(benzoyloxy)benzene
Molecular structure of 1,4-bis(benzoyloxy)benzene
diphenyl benzene-1,2-dicarboxylate
Molecular structure of diphenyl benzene-1,2-dicarboxylate
diphenyl benzene-1,3-dicarboxylate
Molecular structure of diphenyl benzene-1,3-dicarboxylate
diphenyl benzene-1,4-dicarboxylate
Molecular structure of diphenyl benzene-1,4-dicarboxylate
4-(3-oxo-3-phenylprop-1-en-1-yl)phenyl furan-2-carboxylate
Molecular structure of 4-(3-oxo-3-phenylprop-1-en-1-yl)phenyl furan-2-carboxylate
phenolphthalein
Molecular structure of phenolphthalein