phthalic acid


o-benzenedicarboxylic acid; 1,2-benzenedicarboxylic acid; benzene-1,2-dicarboxylic acid; o-phthalic acid; phthalic acid
Links:⚗️ ChemSynthesis, 📖 PubMed
CAS:[88-99-3]
Formula:C8H6O4; 166.13 g/mol
InChiKey:XNGIFLGASWRNHJ-UHFFFAOYSA-N
SMILES:OC(=O)c1ccccc1C(O)=O
Molecular structure of phthalic acid
Density:1.593 g/mL
Molar volume:104.3 mL/mol
Dipole moment:2.60 D
Melting point:234 °C
Log10 partition octanol / water:0.73
1g dissolves in:
3.91g methanol;    8.55g ethanol;    17.99g propanol;    146.20g diethyl ether;    185.19g water

Isomers

benzene-1,3-dicarboxylic acid
Molecular structure of benzene-1,3-dicarboxylic acid
benzene-1,4-dicarboxylic acid
Molecular structure of benzene-1,4-dicarboxylic acid
2-(3,6-dioxo-1-cyclohexa-1,4-dienyl)acetic acid
Molecular structure of 2-(3,6-dioxo-1-cyclohexa-1,4-dienyl)acetic acid
exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride
Molecular structure of exo-3,6-epoxy-1,2,3,6-tetrahydrophthalic anhydride
3-formyl-2-hydroxybenzoic acid
Molecular structure of 3-formyl-2-hydroxybenzoic acid
3-formyl-4-hydroxybenzoic acid
Molecular structure of 3-formyl-4-hydroxybenzoic acid
4-formyl-3-hydroxybenzoic acid
Molecular structure of 4-formyl-3-hydroxybenzoic acid
5-formylsalicylic acid
Molecular structure of 5-formylsalicylic acid
3,4-(methylenedioxy)benzoic acid
Molecular structure of 3,4-(methylenedioxy)benzoic acid
phthalic acid
Molecular structure of phthalic acid