phthalic anhydride


2-benzofuran-1,3-dione; 1,3-dihydro-2-benzofuran-1,3-dione; phthalic anhydride
Links:🌍 Wikipedia, 📏 NIST, 🕷 ChemSpider, 📖 PubMed,
📖Houben-Weyl, 2. Band (Phtalsäure-anhydrid); p. 228, 246, 433, 583, 586, 611, 718
CAS:[85-44-9]
Formula:C8H4O3; 148.12 g/mol
InChiKey:LGRFSURHDFAFJT-UHFFFAOYSA-N
SMILES:O=C1OC(=O)c2ccccc12
Molecular structure of phthalic anhydride
Density:1.527 g/mL
Molar volume:97.0 mL/mol
Dipole moment:5.34 D
Melting point:132 °C
Boiling point:287 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Critical pressure:4.7 atm
Log10 partition octanol / water:1.60
1g dissolves in:
1.20g pyridine;    21.41g formic acid;    142.86g carbon disulfide;    161.45g water