phthalimide


1H-isoindole-1,3(2H)-dione; isoindole-1,3-dione; phthalimide
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis,
📖Houben-Weyl, 2. Band (Phtalimid); p. 114, 136, 142, 234, 281
CAS:[85-41-6]
Formula:C8H5NO2; 147.13 g/mol
InChiKey:XKJCHHZQLQNZHY-UHFFFAOYSA-N
SMILES:O=C1NC(=O)c2ccccc12
Molecular structure of phthalimide
Density:1.210 g/mL
Molar volume:121.6 mL/mol
Dipole moment:2.17 D
Melting point:235 °C
Log10 partition octanol / water:1.15
1g dissolves in:
7.07g pyridine;    1,666.67g water

Isomers

agrocybin
Molecular structure of agrocybin
1,3-benzodioxole-5-carbonitrile
Molecular structure of 1,3-benzodioxole-5-carbonitrile
benzoyl isocyanate
Molecular structure of benzoyl isocyanate
2-cyanobenzoic acid
Molecular structure of 2-cyanobenzoic acid
3-cyanobenzoic acid
Molecular structure of 3-cyanobenzoic acid
4-cyanobenzoic acid
Molecular structure of 4-cyanobenzoic acid
1-ethynyl-4-nitrobenzene
Molecular structure of 1-ethynyl-4-nitrobenzene
3-hydroxy-2-oxoindole
Molecular structure of 3-hydroxy-2-oxoindole
1H-indole-2,3-dione
Molecular structure of 1H-indole-2,3-dione
phthalimide
Molecular structure of phthalimide