salicin


(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[2-(hydroxymethyl)phenoxy]oxane-3,4,5-triol; 2-(hydroxymethyl)phenyl β-D-glucopyranoside; salicin; d-salicin
Links:🌍 Wikipedia, 📏 NIST, 🕷 ChemSpider, 📖 PubMed
MeSH:Analgesics; Anti-Inflammatory Agents, Non-Steroidal; Enzyme Inhibitors; Sensory System Agents
CAS:[138-52-3]
Formula:C13H18O7; 286.28 g/mol
InChiKey:NGFMICBWJRZIBI-UJPOAAIJSA-N
SMILES:OC[C@H]1O[C@@H](Oc2ccccc2CO)[C@H](O)[C@@H](O)[C@@H]1O
Molecular structure of salicin
Melting point:199 °C
Log10 partition octanol / water:-1.22
1g dissolves in:
24.04g water;    7,692.31g trichloroethene

Isomers

2-methoxyphenyl β-D-glucopyranoside
Molecular structure of 2-methoxyphenyl b-D-glucopyranoside
4-methoxyphenyl α-D-glucopyranoside
Molecular structure of 4-methoxyphenyl a-D-glucopyranoside
4-methoxyphenyl β-D-glucopyranoside
Molecular structure of 4-methoxyphenyl b-D-glucopyranoside
phenyl β-D-glycero-D-gulo-heptopyranoside
Molecular structure of phenyl b-D-glycero-D-gulo-heptopyranoside
salicin
Molecular structure of salicin