santonin


santonin; (-)-α-santonin; α-santonin; (3S,3αS,5αS,9βS)-3,5α,9-trimethyl-3α,4,5,9β-tetrahydro-3H-naphtho[7,8-δ]furan-2,8-dione
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
MeSH:Anthelmintics; Anti-Infective Agents
CAS:[481-06-1]
Formula:C15H18O3; 246.31 g/mol
InChiKey:XJHDMGJURBVLLE-BOCCBSBMSA-N
SMILES:C[C@H]1[C@@H]2CC[C@@]3(C)C=CC(=O)C(=C3[C@H]2OC1=O)C
Molecular structure of santonin
Melting point:172 °C
1g dissolves in:
6.86g pyridine;    39.68g trichloroethene;    5,000.00g water

Isomers

ambrosin
Molecular structure of ambrosin
irofulven
Molecular structure of irofulven
loxoprofen
Molecular structure of loxoprofen
santonin
Molecular structure of santonin