sucrose


cane sugar; (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol; β-D-fructofuranosyl-α-D-glucopyranoside; sacharose; sucrose
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Rohrzucker); p. 425, 465, 511, 969,
📖Org. Chem., v. Richter, 1. Vol (Beet Sugar); p. 121
MeSH:Food Additives; Food Additives
CAS:[57-50-1]
Formula:C12H22O11; 342.30 g/mol
InChiKey:CZMRCDWAGMRECN-UGDNZRGBSA-N
SMILES:OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O
Molecular structure of sucrose
Density:1.580 g/mL
Molar volume:216.6 mL/mol
Melting point:188 °C
Log10 partition octanol / water:-3.70
1g dissolves in:
0.49g water;    14.51g pyridine

Isomers

α,a-trehalose
Molecular structure of a,a-trehalose
β,b-trehalose
Molecular structure of b,b-trehalose
cellobiose
Molecular structure of cellobiose
β-cellobiose
Molecular structure of b-cellobiose
gentiobiose
Molecular structure of gentiobiose
2-O-α-D-glucopyranosyl-D-glucose
Molecular structure of 2-O-a-D-glucopyranosyl-D-glucose
3-O-α-D-glucopyranosyl-D-glucose
Molecular structure of 3-O-a-D-glucopyranosyl-D-glucose
4-O-α-D-glucopyranosyl-D-glucose
Molecular structure of 4-O-a-D-glucopyranosyl-D-glucose
6-O-α-D-glucopyranosyl-D-glucose
Molecular structure of 6-O-a-D-glucopyranosyl-D-glucose
lactose
Molecular structure of lactose
β-lactose
Molecular structure of b-lactose
lactulose
Molecular structure of lactulose
laminaribiose
Molecular structure of laminaribiose
α-maltose
Molecular structure of a-maltose
β-maltose
Molecular structure of b-maltose
sophorose
Molecular structure of sophorose
sucrose
Molecular structure of sucrose
α,β-trehalose
Molecular structure of a,b-trehalose