sulfonal


2,2-bis(ethylsulfonyl)propane; sulfonal
Links:🌍 Wikipedia, 📏 NIST, 🕷 ChemSpider
CAS:[115-24-2]
Formula:C7H16O4S2; 228.33 g/mol
InChiKey:CESKLHVYGRFMFP-UHFFFAOYSA-N
SMILES:CC[S](=O)(=O)C(C)(C)[S](=O)(=O)CC
Molecular structure of sulfonal
Melting point:126 °C
1g dissolves in:
454.55g water