tributyl citrate


butyl citrate; n-butyl citrate; citric acid tri-n-butyl ester; tri-n-butyl citrate; tributyl citrate; 1,2,3-tributyl 2-hydroxypropane-1,2,3-tricarboxylate; tributyl 2-hydroxypropane-1,2,3-tricarboxylate
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS RN:[77-94-1]
Formula:C18H32O7; 360.45 g/mol
InChiKey:ZFOZVQLOBQUTQQ-UHFFFAOYSA-N
SMILES:CCCCOC(=O)CC(O)(CC(=O)OCCCC)C(=O)OCCCC
Molecular structure of tributyl citrate
Use:antifoaming agent for water dispersions; solvent plasticizer for nitrocellulose, lacquers, cellulose acetate, ethyl cellulose, and many other resins
Density:1.042 g/mL
Molar volume:345.9 mL/mol
Refractive index:1.445
Molecular refractive power:92.12 mL/mol
Melting point:-20 °C