triethyl 2-hydroxypropan-1,2,3-tricarboxylate


citric acid triethyl ester; ethyl citrate; triethyl citrate; 1,2,3-triethyl 2-hydroxypropane-1,2,3-tricarboxylate; triethyl 2-hydroxypropane-1,2,3-tricarboxylate; triethyl 2-hydroxypropan-1,2,3-tricarboxylate
Links:🌍 Wikipedia, 📖 PubMed
CAS RN:[77-93-0]
Formula:C12H20O7; 276.29 g/mol
InChiKey:DOOTYTYQINUNNV-UHFFFAOYSA-N
SMILES:CCOC(=O)CC(O)(CC(=O)OCC)C(=O)OCC
Molecular structure of triethyl 2-hydroxypropan-1,2,3-tricarboxylate
Use:agglutinant; fixative in flavoring essences; paint removers; plasticizer for cellulose acetate and cellulose nitrate; softener
Density:1.137 g/mL
Molar volume:243.0 mL/mol
Refractive index:1.466
Molecular refractive power:67.30 mL/mol
Melting point:-55 °C
Boiling point:294 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature