tris(2-methylphenyl) phosphate


o-tolyl phosphate; tri-o-cresyl phosphate; tris(2-methylphenyl) phosphate; tri-o-tolyl phosphate; tri-o-tolylphosphate
Links:📖 PubMed
CAS RN:[78-30-8]
Formula:C21H21O4P; 368.37 g/mol
InChiKey:YSMRWXYRXBRSND-UHFFFAOYSA-N
SMILES:Cc1ccccc1O[P](=O)(Oc2ccccc2C)Oc3ccccc3C
Molecular structure of tris(2-methylphenyl) phosphate
Dipole moment:2.87 D
Melting point:-33 °C
Boiling point:410 °C
Log10 partition octanol / water:5.11

Isomers

isopropylphenyl diphenyl phosphate
Molecular structure of isopropylphenyl diphenyl phosphate
tricresyl phosphate
Molecular structure of tricresyl phosphate
tris(2-methylphenyl) phosphate
Molecular structure of tris(2-methylphenyl) phosphate
tris(3-methylphenyl) phosphate
Molecular structure of tris(3-methylphenyl) phosphate