veratridine


veratridine; veratrine
Links:🕷 ChemSpider
CAS:[71-62-5]
Formula:C36H51NO11; 673.80 g/mol
InChiKey:FVECELJHCSPHKY-YFUMOZOISA-N
SMILES:COc1ccc(cc1OC)C(=O)O[C@H]2CC[C@@]3(C)[C@@H]4CC[C@H]5[C@]6(O)C[C@H](O)[C@@]7(O)[C@@H](CN8C[C@@H](C)CC[C@H]8[C@@]7(C)O)[C@]6(O)C[C@]35O[C@]24O
Molecular structure of veratridine
Melting point:170 °C
1g dissolves in:
0.37g diethylamine;    0.57g pyridine;    1.20g piperidine;    2.70g aniline;    1,754.39g water