2-nitroaniline


o-nitroaniline; 2-nitroaniline; 2-nitrobenzenamine
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[88-74-4]
Formula:C6H6N2O2; 138.13 g/mol
InChiKey:DPJCXCZTLWNFOH-UHFFFAOYSA-N
SMILES:Nc1ccccc1[N+]([O-])=O
Molecular structure of 2-nitroaniline
Density:1.442 g/mL
Molar volume:95.8 mL/mol
Dielectric constant:34.60
Dipole moment:4.36 D
Melting point:71 °C
Boiling point:284 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Critical pressure:4.4 atm
Log10 partition octanol / water:3.07
1g dissolves in:
800.00g water

Isomers

4-aminonicotinic acid
Molecular structure of 4-aminonicotinic acid
2-aminopyridine-3-carboxylic acid
Molecular structure of 2-aminopyridine-3-carboxylic acid
2-aminopyridine-4-carboxylic acid
Molecular structure of 2-aminopyridine-4-carboxylic acid
3-aminopyridine-4-carboxylic acid
Molecular structure of 3-aminopyridine-4-carboxylic acid
5-aminopyridine-2-carboxylic acid
Molecular structure of 5-aminopyridine-2-carboxylic acid
6-aminopyridine-2-carboxylic acid
Molecular structure of 6-aminopyridine-2-carboxylic acid
6-amino-3-pyridinecarboxylic acid
Molecular structure of 6-amino-3-pyridinecarboxylic acid
1,2-benzoquinone dioxime
Molecular structure of 1,2-benzoquinone dioxime
1,4-benzoquinone dioxime
Molecular structure of 1,4-benzoquinone dioxime
1,1-dicyanoethyl acetate
Molecular structure of 1,1-dicyanoethyl acetate
3-hydroxypyridine-2-carboxamide
Molecular structure of 3-hydroxypyridine-2-carboxamide
(E)-4-imidazoleacrylic acid
Molecular structure of (E)-4-imidazoleacrylic acid
3-methyl-5-nitropyridine
Molecular structure of 3-methyl-5-nitropyridine
4-methyl-3-nitropyridine
Molecular structure of 4-methyl-3-nitropyridine
methyl pyrazine-2-carboxylate
Molecular structure of methyl pyrazine-2-carboxylate
2-methylpyrazine-5-carboxylic acid
Molecular structure of 2-methylpyrazine-5-carboxylic acid
5-methyl-2-pyrazinecarboxylic acid
Molecular structure of 5-methyl-2-pyrazinecarboxylic acid
methyl pyridazine-4-carboxylate
Molecular structure of methyl pyridazine-4-carboxylate
2-nitroaniline
Molecular structure of 2-nitroaniline
3-nitroaniline
Molecular structure of 3-nitroaniline
4-nitroaniline
Molecular structure of 4-nitroaniline
N-phenylnitramide
Molecular structure of N-phenylnitramide
urocanic acid
Molecular structure of urocanic acid
5-vinyluracil
Molecular structure of 5-vinyluracil