1,4-dinitrobenzene


p-dinitrobenzene; 1,4-dinitrobenzene
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[100-25-4]
Formula:C6H4N2O4; 168.11 g/mol
InChiKey:FYFDQJRXFWGIBS-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1ccc(cc1)[N+]([O-])=O
Molecular structure of 1,4-dinitrobenzene
Density:1.625 g/mL
Molar volume:103.5 mL/mol
Dipole moment:0.00 D
Melting point:172 °C
Boiling point:299 °C
Log10 partition octanol / water:1.47
1g dissolves in:
1.88g pyridine;    75.76g water

Isomers

1,2-dinitrobenzene
Molecular structure of 1,2-dinitrobenzene
1,3-dinitrobenzene
Molecular structure of 1,3-dinitrobenzene
1,4-dinitrobenzene
Molecular structure of 1,4-dinitrobenzene
2,4-dinitrosobenzene-1,3-diol
Molecular structure of 2,4-dinitrosobenzene-1,3-diol
6-nitropyridine-2-carboxylic acid
Molecular structure of 6-nitropyridine-2-carboxylic acid
2,3-pyrazinedicarboxylic acid
Molecular structure of 2,3-pyrazinedicarboxylic acid