2-bromobutanedioic acid


(+-)-bromobutanedioic acid, 2-bromobutanedioic acid, bromosuccinic acid, monobromosuccinic acid, rac-bromobutanedioic acid
Links:🕷 ChemSpider
CAS:[923-06-8]
Formula:C4H5BrO4; 196.99 g/mol
InChiKey:QQWGVQWAEANRTK-UHFFFAOYSA-N
SMILES:OC(=O)CC(Br)C(O)=O
Molecular structure of 2-bromobutanedioic acid
Melting point:161 °C
1g dissolvs in:
0.77g methanol;    1.20g ethanol;    2.02g propanol