3-nitrophthalic acid


3-nitrobenzene-1,2-dicarboxylic acid; α-nitro-o-phthalic acid; 3-nitrophthalic acid
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS RN:[603-11-2]
Formula:C8H5NO6; 211.13 g/mol
InChiKey:KFIRODWJCYBBHY-UHFFFAOYSA-N
SMILES:OC(=O)c1cccc(c1C(O)=O)[N+]([O-])=O
Molecular structure of 3-nitrophthalic acid
Melting point:219 °C
Log10 partition octanol / water:0.75
1g dissolves in:
47.85g water

Isomers

2-nitro-1,3-benzenedicarboxylic acid
Molecular structure of 2-nitro-1,3-benzenedicarboxylic acid
2-nitrobenzene-1,4-dicarboxylic acid
Molecular structure of 2-nitrobenzene-1,4-dicarboxylic acid
4-nitro-1,3-benzenedicarboxylic acid
Molecular structure of 4-nitro-1,3-benzenedicarboxylic acid
5-nitro-1,3-benzenedicarboxylic acid
Molecular structure of 5-nitro-1,3-benzenedicarboxylic acid
3-nitrophthalic acid
Molecular structure of 3-nitrophthalic acid
4-nitrophthalic acid
Molecular structure of 4-nitrophthalic acid
2,3,4-pyridinetricarboxylic acid
Molecular structure of 2,3,4-pyridinetricarboxylic acid
2,4,6-pyridinetricarboxylic acid
Molecular structure of 2,4,6-pyridinetricarboxylic acid