4-chloro-3-nitrobenzoic acid

Home   ::   Tables for Chemistry   ::   Compound classes

4-chloro-3-nitrobenzoic acid; 1,2,5-nitrochlorobenzoic acid
Links:📏 NIST, 📖 PubMed
CAS RN:[96-99-1]
Formula:C7H4ClNO4; 201.57 g/mol
InChiKey:DFXQXFGFOLXAPO-UHFFFAOYSA-N
SMILES:OC(=O)c1ccc(Cl)c(c1)[N+]([O-])=O
Molecular structure of 4-chloro-3-nitrobenzoic acid
Density:1.645 g/mL
Molar volume:122.5 mL/mol
Melting point:183 °C
1g dissolves in:
103.41g water

Isomers

2-chloro-3-nitrobenzoic acid
Molecular structure of 2-chloro-3-nitrobenzoic acid
2-chloro-4-nitrobenzoic acid
Molecular structure of 2-chloro-4-nitrobenzoic acid
2-chloro-5-nitrobenzoic acid
Molecular structure of 2-chloro-5-nitrobenzoic acid
2-chloro-6-nitrobenzoic acid
Molecular structure of 2-chloro-6-nitrobenzoic acid
3-chloro-2-nitrobenzoic acid
Molecular structure of 3-chloro-2-nitrobenzoic acid
4-chloro-2-nitrobenzoic acid
Molecular structure of 4-chloro-2-nitrobenzoic acid
4-chloro-3-nitrobenzoic acid
Molecular structure of 4-chloro-3-nitrobenzoic acid
5-chloro-2-nitrobenzoic acid
Molecular structure of 5-chloro-2-nitrobenzoic acid
4-nitrophenyl chloroformate
Molecular structure of 4-nitrophenyl chloroformate
  ::