9,10-phenanthraquinone


phenanthraquinone; 9,10-phenanthraquinone; 9,10-phenanthrenedione; phenanthrene-9,10-dione; 9,10-phenanthrenequinone
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Phenanthrenchinon); p. 62, 127, 222, 224, 468, 602, 980, 988
MeSH:Mutagens; Noxae
CAS:[84-11-7]
Formula:C14H8O2; 208.22 g/mol
InChiKey:YYVYAPXYZVYDHN-UHFFFAOYSA-N
SMILES:O=C1C(=O)c2ccccc2c3ccccc13
Molecular structure of 9,10-phenanthraquinone
Density:1.405 g/mL
Molar volume:148.2 mL/mol
Melting point:206 °C
Boiling point:360 °C
Log10 partition octanol / water:2.52
1g dissolves in:
40.63g trichloromethane;    159.74g ethyl acetate;    185.87g benzene;    4,000.00g pentane

Isomers

anthraquinone
Molecular structure of anthraquinone
9,10-phenanthraquinone
Molecular structure of 9,10-phenanthraquinone