9,10-phenanthraquinone


9,10-phenanthraquinone, 9,10-phenanthrenedione, 9,10-phenanthrenequinone, phenanthraquinone, phenanthrene-9,10-dione
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
MeSH:Mutagens; Noxae
CAS:[84-11-7]
Formula:C14H8O2; 208.22 g/mol
InChiKey:YYVYAPXYZVYDHN-UHFFFAOYSA-N
SMILES:O=C1C(=O)c2ccccc2c3ccccc13
Molecular structure of 9,10-phenanthraquinone
Density:1.405 g/mL
Molar volume:148.2 mL/mol
Melting point:206 °C
Boiling point:360 °C
Log10 partition octanol / water:2.52
1g dissolvs in:
40.63g trichloromethane;    159.74g ethyl acetate;    185.87g benzene;    4,000.00g pentane

Isomers

9,10-phenanthraquinone
Molecular structure of 9,10-phenanthraquinone
anthraquinone
Molecular structure of anthraquinone