L-malic acid


L-hydroxybutanedioic acid; (2S)-2-hydroxybutanedioic acid; (S)-2-hydroxysuccinic acid; (-)-malic acid; L-(-)-malic acid; L-malic acid
Links:📏 NIST, 📖 PubMed
CAS RN:[97-67-6]
Formula:C4H6O5; 134.09 g/mol
InChiKey:BJEPYKJPYRNKOW-REOHCLBHSA-N
SMILES:O[C@@H](CC(O)=O)C(O)=O
Molecular structure of L-malic acid
Density:1.600 g/mL
Molar volume:83.8 mL/mol
Melting point:98 °C
Log10 partition octanol / water:-1.26
1g dissolves in:
0.60g methanol;    1.09g ethanol;    1.85g propanol;    10,000.00g trichloroethene

Isomers

2-(carboxymethyloxy)acetic acid
Molecular structure of 2-(carboxymethyloxy)acetic acid
hydroxybutanedioic acid
Molecular structure of hydroxybutanedioic acid
(2R)-2-hydroxybutanedioic acid
Molecular structure of (2R)-2-hydroxybutanedioic acid
L-malic acid
Molecular structure of L-malic acid
2,2'-oxybis-acetic acid
Molecular structure of 2,2'-oxybis-acetic acid