L-valine


L-α-aminoisovaleric acid; (2S)-2-amino-3-methylbutanoic acid; (S)-2-amino-3-methylbutanoic acid; (S)-α-amino-β-methylbutyric acid; L-α-amino-β-methylbutyric acid; (S)-(+)-valine; L-(+)-valine; L-valine; valine
Links:📏 NIST,
📖Houben-Weyl, 2. Band (Valin); p. 872,
📖Org. Chem., v. Richter, 1. Vol (Valine); p. 389, 667
CAS:[72-18-4]
Formula:C5H11NO2; 117.15 g/mol
InChiKey:KZSNJWFQEVHDMF-BYPYZUCNSA-N
SMILES:CC(C)[C@H](N)C(O)=O
Molecular structure of L-valine
Density:1.316 g/mL
Molar volume:89.0 mL/mol
Melting point:315 °C
Log10 partition octanol / water:-2.26

Isomers

2-amino-2-methylbutanoic acid
Molecular structure of 2-amino-2-methylbutanoic acid
3-amino-3-methylbutanoic acid
Molecular structure of 3-amino-3-methylbutanoic acid
2-aminopentanoic acid
Molecular structure of 2-aminopentanoic acid
3-aminopentanoic acid
Molecular structure of 3-aminopentanoic acid
5-aminopentanoic acid
Molecular structure of 5-aminopentanoic acid
betaine
Molecular structure of betaine
butyl carbamate
Molecular structure of butyl carbamate
tert-butyl carbamate
Molecular structure of tert-butyl carbamate
diethyl imidocarbonate
Molecular structure of diethyl imidocarbonate
N,N-dimethyl-1,3-dioxolan-2-amine
Molecular structure of N,N-dimethyl-1,3-dioxolan-2-amine
N,N-dimethylurethane
Molecular structure of N,N-dimethylurethane
N-ethylalanine
Molecular structure of N-ethylalanine
2-ethylaminopropanoic acid
Molecular structure of 2-ethylaminopropanoic acid
ethyl N-ethylcarbamate
Molecular structure of ethyl N-ethylcarbamate
2-hydroxy-N,N-dimethylpropanamide
Molecular structure of 2-hydroxy-N,N-dimethylpropanamide
methyl 2-aminobutanoate
Molecular structure of methyl 2-aminobutanoate
methyl 3-aminobutanoate
Molecular structure of methyl 3-aminobutanoate
2-methylaminomethyl-1,3-dioxolane
Molecular structure of 2-methylaminomethyl-1,3-dioxolane
3-methylbutyl nitrite
Molecular structure of 3-methylbutyl nitrite
methyl 2-dimethylaminoacetate
Molecular structure of methyl 2-dimethylaminoacetate
2-methyl-2-methylaminopropanoic acid
Molecular structure of 2-methyl-2-methylaminopropanoic acid
4-methylmorpholine 4-oxide
Molecular structure of 4-methylmorpholine 4-oxide
2-methyl-2-nitrobutane
Molecular structure of 2-methyl-2-nitrobutane
3-methyl-1-nitrobutane
Molecular structure of 3-methyl-1-nitrobutane
2-methylpropyl carbamate
Molecular structure of 2-methylpropyl carbamate
1-nitropentane
Molecular structure of 1-nitropentane
3-nitropentane
Molecular structure of 3-nitropentane
D-norvaline
Molecular structure of D-norvaline
norvaline
Molecular structure of norvaline
pentyl nitrite
Molecular structure of pentyl nitrite
N-propylglycine
Molecular structure of N-propylglycine
propyl N-methylcarbamate
Molecular structure of propyl N-methylcarbamate
O-(tetrahydro-2H-pyran-2-yl)hydroxylamine
Molecular structure of O-(tetrahydro-2H-pyran-2-yl)hydroxylamine
D-valine
Molecular structure of D-valine
dl-valine
Molecular structure of dl-valine
L-valine
Molecular structure of L-valine