bis(2-methoxyphenyl) carbonate


bis(2-methoxyphenyl) carbonate; guaiacol carbonate
CAS:[553-17-3]
Formula:C15H14O5; 274.27 g/mol
InChiKey:ORUJFMPWKPVXLZ-UHFFFAOYSA-N
SMILES:COc1ccccc1OC(=O)Oc2ccccc2OC
Molecular structure of bis(2-methoxyphenyl) carbonate
Melting point:87 °C
1g dissolves in:
1.50g trichloromethane;    12.56g diethyl ether;    48.08g ethanol

Isomers

bis(2-hydroxy-4-methoxyphenyl)methanone
Molecular structure of bis(2-hydroxy-4-methoxyphenyl)methanone
bis(2-methoxyphenyl) carbonate
Molecular structure of bis(2-methoxyphenyl) carbonate
bis(4-methoxyphenyl) carbonate
Molecular structure of bis(4-methoxyphenyl) carbonate
5,8-diethoxypsoralen
Molecular structure of 5,8-diethoxypsoralen
phloretin
Molecular structure of phloretin