citric acid


2-hydroxy-1,2,3-propanetricarboxylic acid, 2-hydroxypropane-1,2,3-tricarboxylic acid, 3-carboxy-3-hydroxypentanedioic acid, citric acid, citric acid, anhydrous
Links:📏 NIST
MeSH:Calcium Chelating Agents; Hematologic Agents
CAS:[77-92-9]
Formula:C6H8O7; 192.13 g/mol
InChiKey:KRKNYBCHXYNGOX-UHFFFAOYSA-N
SMILES:OC(=O)CC(O)(CC(O)=O)C(O)=O
Molecular structure of citric acid
Density:1.665 g/mL
Molar volume:115.4 mL/mol
Melting point:153 °C
Boiling point:310 °C
Log10 partition octanol / water:-1.72
1g dissolvs in:
0.51g methanol;    1.59g propanol;    1.61g ethanol;    8.16g formic acid;    23.70g pentyl acetate;    95.24g diethyl ether;    8,333.33g trichloroethene;    infg tetrachloromethane;    infg toluene;    infg trichloromethane;    infg benzene

Isomers

citric acid
Molecular structure of citric acid
isocitric acid
Molecular structure of isocitric acid