citric acid hydrate


citric acid hydrate; citric acid monohydrate
Links:📏 NIST, 📖 PubMed
CAS RN:[5949-29-1]
Formula:C6H10O8; 210.14 g/mol
InChiKey:YASYEJJMZJALEJ-UHFFFAOYSA-N
SMILES:O.OC(=O)CC(O)(CC(O)=O)C(O)=O
Molecular structure of citric acid hydrate
Density:1.540 g/mL
Molar volume:136.5 mL/mol
Melting point:100 °C
Log10 partition octanol / water:-1.64
1g dissolves in:
0.48g water

Isomers

D-altraric acid
Molecular structure of D-altraric acid
L-altraric acid
Molecular structure of L-altraric acid
citric acid hydrate
Molecular structure of citric acid hydrate
glucaric acid
Molecular structure of glucaric acid
mucic acid
Molecular structure of mucic acid