d-camphor


(+)-camphor; (1R)-(+)-camphor; (1R)-camphor; (1R,4R)-(+)-camphor; (R)-(+)-camphor; (R)-camphor; d-camphor; (1R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
Links:📖 PubMed
CAS:[464-49-3]
Formula:C10H16O; 152.24 g/mol
InChiKey:DSSYKIVIOFKYAU-XVKPBYJWSA-N
SMILES:CC1(C)[C@H]2CC[C@@]1(C)C(=O)C2
Molecular structure of d-camphor
Density:0.990 g/mL
Molar volume:153.8 mL/mol
Dipole moment:3.05 D
Melting point:179 °C
Boiling point:209 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:2.74
1g dissolves in:
0.25g trichloromethane;    0.50g acetic acid;    0.58g diethyl ether;    909.09g water

Isomers

1-adamantanol
Molecular structure of 1-adamantanol
2-adamantanol
Molecular structure of 2-adamantanol
camphor
Molecular structure of camphor
d-camphor
Molecular structure of d-camphor
(1S)-camphor
Molecular structure of (1S)-camphor
caron
Molecular structure of caron
(-)-carveol
Molecular structure of (-)-carveol
α-cyclocitral
Molecular structure of a-cyclocitral
2-cyclopentylcyclopentan-1-one
Molecular structure of 2-cyclopentylcyclopentan-1-one
trans,trans-2,4-decadienal
Molecular structure of trans,trans-2,4-decadienal
trans-1-decalone
Molecular structure of trans-1-decalone
trans-2-decalone
Molecular structure of trans-2-decalone
(+)-dihydrocarvone
Molecular structure of (+)-dihydrocarvone
dihydrocarvone
Molecular structure of dihydrocarvone
(1S,4S)-dihydrocarvone
Molecular structure of (1S,4S)-dihydrocarvone
(1R)-6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-methanol
Molecular structure of (1R)-6,6-dimethylbicyclo[3.1.1]hept-2-ene-2-methanol
(2E)-3,7-dimethyl-2,6-octadienal
Molecular structure of (2E)-3,7-dimethyl-2,6-octadienal
(Z)-3,7-dimethyl-2,6-octadienal
Molecular structure of (Z)-3,7-dimethyl-2,6-octadienal
(3E)-3,7-dimethylocta-3,6-dienal
Molecular structure of (3E)-3,7-dimethylocta-3,6-dienal
3,7-dimethyloct-6-en-1-yn-3-ol
Molecular structure of 3,7-dimethyloct-6-en-1-yn-3-ol
(1R)-(-)-fenchone
Molecular structure of (1R)-(-)-fenchone
fenchone
Molecular structure of fenchone
1-formyl-2,6,6-trimethylcyclohexene
Molecular structure of 1-formyl-2,6,6-trimethylcyclohexene
ipsdienol
Molecular structure of ipsdienol
(2S,5S)-5-isopropenyl-2-methylcyclohexanone
Molecular structure of (2S,5S)-5-isopropenyl-2-methylcyclohexanone
(5R)-2-isopropylidene-5-methylcyclohexanone
Molecular structure of (5R)-2-isopropylidene-5-methylcyclohexanone
(1S,4R)-1-isopropyl-4-methylbicyclo[3.1.0]hexan-3-one
Molecular structure of (1S,4R)-1-isopropyl-4-methylbicyclo[3.1.0]hexan-3-one
(1S,4S,5R)-1-isopropyl-4-methylbicyclo[3.1.0]hexan-3-one
Molecular structure of (1S,4S,5R)-1-isopropyl-4-methylbicyclo[3.1.0]hexan-3-one
5-isopropyl-2-methyl-2-cyclohexenone
Molecular structure of 5-isopropyl-2-methyl-2-cyclohexenone
isothujone
Molecular structure of isothujone
(+)-limonene 1,2-epoxide
Molecular structure of (+)-limonene 1,2-epoxide
limonene-10-ol
Molecular structure of limonene-10-ol
4-methylene-2-(2-methylprop-1-en-1-yl)tetrahydro-2H-pyran
Molecular structure of 4-methylene-2-(2-methylprop-1-en-1-yl)tetrahydro-2H-pyran
(1S,5R)-4-methyl-1-propan-2-ylbicyclo[3.1.0]hexan-3-one
Molecular structure of (1S,5R)-4-methyl-1-propan-2-ylbicyclo[3.1.0]hexan-3-one
(5S)-2-methyl-5-propan-2-ylcyclohex-2-en-1-one
Molecular structure of (5S)-2-methyl-5-propan-2-ylcyclohex-2-en-1-one
3-methyl-5-propan-2-ylcyclohex-2-en-1-one
Molecular structure of 3-methyl-5-propan-2-ylcyclohex-2-en-1-one
(6R)-3-methyl-6-(propan-2-yl)cyclohex-2-en-1-one
Molecular structure of (6R)-3-methyl-6-(propan-2-yl)cyclohex-2-en-1-one
(6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-one
Molecular structure of (6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-one
(5S)-5-methyl-2-propan-2-ylidenecyclohexan-1-one
Molecular structure of (5S)-5-methyl-2-propan-2-ylidenecyclohexan-1-one
3-methyl-6-propan-2-ylidenecyclohex-2-en-1-ol
Molecular structure of 3-methyl-6-propan-2-ylidenecyclohex-2-en-1-ol
2-(2-methyl-2-propenyl)cyclohexanone
Molecular structure of 2-(2-methyl-2-propenyl)cyclohexanone
3-methyl-5-propylcyclohex-2-en-1-one
Molecular structure of 3-methyl-5-propylcyclohex-2-en-1-one
perillyl alcohol
Molecular structure of perillyl alcohol
α-pinene oxide
Molecular structure of a-pinene oxide
piperitone
Molecular structure of piperitone
(1R-(1α,2β,4β,6α))-2,2,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane
Molecular structure of (1R-(1a,2b,4b,6a))-2,2,7-trimethyl-3-oxatricyclo[4.1.1.02,4]octane
spiro[4.5]decan-6-one
Molecular structure of spiro[4.5]decan-6-one
4,4,6,6-tetramethyl-2-cyclohexen-1-one
Molecular structure of 4,4,6,6-tetramethyl-2-cyclohexen-1-one
α-thujone
Molecular structure of a-thujone
(1S,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-one
Molecular structure of (1S,4R)-1,3,3-trimethylbicyclo[2.2.1]heptan-2-one
(1S,2S,5S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol
Molecular structure of (1S,2S,5S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-en-2-ol
2,6,6-trimethyl-2-cycloheptenone
Molecular structure of 2,6,6-trimethyl-2-cycloheptenone
2,6,6-trimethylcyclohexene-1-carbaldehyde
Molecular structure of 2,6,6-trimethylcyclohexene-1-carbaldehyde
4,7,7-trimethyl-6-oxabicyclo[3.2.1]oct-3-ene
Molecular structure of 4,7,7-trimethyl-6-oxabicyclo[3.2.1]oct-3-ene
cis-verbenol
Molecular structure of cis-verbenol