hyoscyamine hydrobromide


hyoscyamine hydrobromide; (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 3-hydroxy-2-phenylpropanoate hydrobromide
Links:🕷 ChemSpider
CAS:[306-03-6]
Formula:C17H24BrNO3; 370.29 g/mol
InChiKey:VZDNSFSBCMCXSK-UHFFFAOYSA-N
SMILES:[H+].[Br-].CN1C2CCC1CC(C2)OC(=O)C(CO)c3ccccc3
Molecular structure of hyoscyamine hydrobromide
1g dissolves in:
2.00g ethanol;    2.50g trichloromethane;    1,612.90g diethyl ether