nitrobenzene


nitrobenzene; nitrobenzide; nitrobenzol
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Nitrobenzol); p. 13, 148, 154, 312, 334, 338, 342, 347, 358, 400, 413, 417, 433, 435, 723, 882, 963, 979
CAS RN:[98-95-3]
Formula:C6H5NO2; 123.11 g/mol
InChiKey:LQNUZADURLCDLV-UHFFFAOYSA-N
SMILES:O=[N+]([O-])c1ccccc1
Molecular structure of nitrobenzene
Use:essence of mirbane; essence of myrbane; manufacture of aniline, azobenzene, benzidine, cements, cosmetics, dye intermediates, dyes, dust preventatives, explosives, glues, greases, various other organic chemicals, polishes, soaps, synthetic oil of almonds, toilet preparations, etc.; oil of mirbane; oil of myrbane
Density:1.204 g/mL
Molar volume:102.3 mL/mol
Refractive index:1.552
Molecular refractive power:32.67 mL/mol
Dielectric constant:34.80
Dipole moment:4.28 D
Melting point:6 °C
Boiling point:211 °C
Vapour pressure:0 Torr
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Surface tension:43.90 dyn/cm
Viscosity:1.80 cP
Critical temperature:447 °C
Critical pressure:47.6 atm
Solubility in water:0 % w/w
Log10 partition octanol / water:1.86
Snyder P':4.4
Snyder X:Xe: 0.3    Xd: 0.3    Xn: 0.4
Dimroth ET:41.2
Hildebrant solubility parameter (δ):10.0
Hansen solubility parameter:δd: 9.8 (cal/mL)½   δp: 4.2 (cal/mL)½   δh: 2.0 (cal/mL)½
100g dissolves:
57.2g 4-nitrobenzyl chloride;    48.8g benzophenone;    10.05g benzoic acid;    4.26g iodine;    1.26g octadecanoic acid;    0.5g camphoric acid
Specific heat capacity:44.0 cal/molK
Latent heat of fusion:2,768 cal/mol

Isomers

4-hydroxyimino-2,5-cyclohexadien-1-one
Molecular structure of 4-hydroxyimino-2,5-cyclohexadien-1-one
nitrobenzene
Molecular structure of nitrobenzene
4-nitrosophenol
Molecular structure of 4-nitrosophenol
4-pyridinecarboxaldehyde N-oxide
Molecular structure of 4-pyridinecarboxaldehyde N-oxide
pyridine-2-carboxylic acid
Molecular structure of pyridine-2-carboxylic acid
3-pyridinecarboxylic acid
Molecular structure of 3-pyridinecarboxylic acid
4-pyridinecarboxylic acid
Molecular structure of 4-pyridinecarboxylic acid