benzophenone


benzophenone, diphenyl ketone, diphenylmethanone
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
MeSH:Photosensitizing Agents; Radiation-Sensitizing Agents
CAS:[119-61-9]
Formula:C13H10O; 182.22 g/mol
InChiKey:RWCCWEUUXYIKHB-UHFFFAOYSA-N
SMILES:O=C(c1ccccc1)c2ccccc2
Molecular structure of benzophenone
Density:1.089 g/mL
Molar volume:167.3 mL/mol
Dielectric constant:11.40
Dipole moment:2.95 D
Melting point:49 °C
Boiling point:306 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Critical pressure:3.4 atm
Log10 partition octanol / water:3.18
1g dissolvs in:
1.14g benzene;    1.27g benzene;    1.56g toluene;    1.89g carbon disulfide;    2.05g nitrobenzene;    2.56g ethanol;    2.68g trichloromethane;    4.08g diethyl ether;    4.69g ethyl acetate;    5.52g methanol;    5.85g ethanol;    8.47g tribromomethane;    9.80g hexane

Isomers

(E)-7-phenylhept-2-en-4,6-diyn-1-ol
Molecular structure of (E)-7-phenylhept-2-en-4,6-diyn-1-ol
2-ethynyl-6-methoxynaphthalene
Molecular structure of 2-ethynyl-6-methoxynaphthalene
3-(1-naphthyl)-2-propyn-1-ol
Molecular structure of 3-(1-naphthyl)-2-propyn-1-ol
4-biphenylcarboxaldehyde
Molecular structure of 4-biphenylcarboxaldehyde
9-fluorenol
Molecular structure of 9-fluorenol
9H-fluoren-2-ol
Molecular structure of 9H-fluoren-2-ol
benzophenone
Molecular structure of benzophenone
biphenyl-4-carboxaldehyde
Molecular structure of biphenyl-4-carboxaldehyde
xanthene
Molecular structure of xanthene