pilocarpine


(3S,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]oxolan-2-one; pilocarpine; pilocarpol; (3S-cis)-3-ethyldihydro-4-(1-methyl-1H-imidazol-5-yl)methyl-2(3~H)-furanone
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
MeSH:Autonomic Agents; Cholinergic Agents; Miotics; Neurotransmitter Agents
CAS:[92-13-7]
Formula:C11H16N2O2; 208.26 g/mol
InChiKey:QCHFTSOMWOSFHM-WPRPVWTQSA-N
SMILES:CC[C@H]1[C@H](COC1=O)Cc2cncn2C
Molecular structure of pilocarpine
Melting point:34 °C
Log10 partition octanol / water:0.12
1g dissolves in:
1.70g trichloromethane;    15.02g ethanol;    35.71g diethyl ether

Isomers

aminocarb
Molecular structure of aminocarb
2-(Boc-amino)-3-methylpyridine
Molecular structure of 2-(Boc-amino)-3-methylpyridine
2-(Boc-amino)-6-methylpyridine
Molecular structure of 2-(Boc-amino)-6-methylpyridine
3-(Boc-aminomethyl)pyridine
Molecular structure of 3-(Boc-aminomethyl)pyridine
N-Boc-1,2-phenylenediamine
Molecular structure of N-Boc-1,2-phenylenediamine
1-Boc-2-phenylhydrazine
Molecular structure of 1-Boc-2-phenylhydrazine
tert-butyl N-(pyridin-3-ylmethyl)carbamate
Molecular structure of tert-butyl N-(pyridin-3-ylmethyl)carbamate
2-carbethoxy-7-methyl-4,5,6,7-tetrahydroindazole
Molecular structure of 2-carbethoxy-7-methyl-4,5,6,7-tetrahydroindazole
2-dimethylaminomethyl-(3αR,7αS)-3α,4,7,7α-tetrahydroisoindole-1,3-dione
Molecular structure of 2-dimethylaminomethyl-(3aR,7aS)-3a,4,7,7a-tetrahydroisoindole-1,3-dione
1-(4-ethoxyphenyl)-1-ethylurea
Molecular structure of 1-(4-ethoxyphenyl)-1-ethylurea
2-(ethylamino)ethyl 4-aminobenzoate
Molecular structure of 2-(ethylamino)ethyl 4-aminobenzoate
(3-methyl-2-propoxyphenyl)urea
Molecular structure of (3-methyl-2-propoxyphenyl)urea
pilocarpine
Molecular structure of pilocarpine