triphenylmethane


1,1',1"-methanetriyltribenzene; triphenylmethane
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed
CAS:[519-73-3]
Formula:C19H16; 244.34 g/mol
InChiKey:AAAQKTZKLRYKHR-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(c2ccccc2)c3ccccc3
Molecular structure of triphenylmethane
Density:1.013 g/mL
Molar volume:241.1 mL/mol
Refractive index:1.579
Molecular refractive power:80.10 mL/mol
Dielectric constant:2.45
Dipole moment:0.00 D
Melting point:93 °C
Boiling point:360 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
1g dissolves in:
1.16g pyridine;    1.32g carbon disulfide;    1.41g trichloromethane;    2.86g thiophene;    3.12g pyrrole;    11.11g hexane;    11.17g benzene;    17.54g aniline

Isomers

4-benzylacenaphthene
Molecular structure of 4-benzylacenaphthene
5-benzylacenaphthene
Molecular structure of 5-benzylacenaphthene
4-benzylbiphenyl
Molecular structure of 4-benzylbiphenyl
2,5-cyclohexadienylidenediphenylmethane
Molecular structure of 2,5-cyclohexadienylidenediphenylmethane
1-methyl-3,5-diphenylbenzene
Molecular structure of 1-methyl-3,5-diphenylbenzene
1-(4-methylphenyl)-1-naphth-2-ylethene
Molecular structure of 1-(4-methylphenyl)-1-naphth-2-ylethene
1-(2-methylphenyl)-4-phenylbenzene
Molecular structure of 1-(2-methylphenyl)-4-phenylbenzene
1-(3-methylphenyl)-4-phenylbenzene
Molecular structure of 1-(3-methylphenyl)-4-phenylbenzene
1-(4-methylphenyl)-4-phenylbenzene
Molecular structure of 1-(4-methylphenyl)-4-phenylbenzene
triphenylmethane
Molecular structure of triphenylmethane